Product Name | 5-Azido-5-deoxy-1,2-O-isopropylidene-alpha-D-xylofuranose |
---|---|
CAS | 4711-03-9 |
Formula | C8 H13 N3 O4 |
MW | 215.21 |
MDL | MFCD12547100 |
Melting point | 59.8-60.2 °C |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 5-Azido-5-deoxy-1,2-O-isopropylidene-alpha-D-xylofuranose |
---|---|
CAS | 4711-03-9 |
Formula | C8 H13 N3 O4 |
MW | 215.21 |
MDL | MFCD12547100 |
Melting point | 59.8-60.2 °C |
CAS | 4711-03-9 |
---|---|
Formula | C8 H13 N3 O4 |
MW | 215.21 |
MDL | MFCD12547100 |
Melting point | 59.8-60.2 °C |
Smiles | O1C(C)(C)O[C@]2([H])[C@]1([C@H]([C@H](O2)CN=[N+]=[N-])O)[H] |&1:5,7,8,9,r| |
InchiKey | ADXRFTODQJSRBR-TWULDSOMNA-N |