Product Name | 1,4-Benzenedicarboxaldehyde dioxime |
---|---|
CAS | 18705-39-0 |
Formula | C8 H8 N2 O2 |
MW | 164.16 |
MDL | MFCD00040201 |
Melting point | 211.5-212.0 °C |
Boiling point | 288.0±23.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 1,4-Benzenedicarboxaldehyde dioxime |
---|---|
CAS | 18705-39-0 |
Formula | C8 H8 N2 O2 |
MW | 164.16 |
MDL | MFCD00040201 |
Melting point | 211.5-212.0 °C |
Boiling point | 288.0±23.0 °C(Predicted) |
CAS | 18705-39-0 |
---|---|
Formula | C8 H8 N2 O2 |
MW | 164.16 |
MDL | MFCD00040201 |
Melting point | 211.5-212.0 °C |
Boiling point | 288.0±23.0 °C(Predicted) |
Smiles | C1(C=CC(/C=N/O)=CC=1)/C=N/O |
InchiKey | UFJKQCPYFKAUEO-NXZHAISVSA-N |