Chinese alias | 1-(2-Methylpropyl)-1H-imidazole[4,5-c]quinoline-4-amine, Imiquimod - CAS 99011-02-6 - Calbiochem |
CAS | 99011-02-6 |
Formula | C14H16N4 |
MW | 240.3 |
Appearance | white solid |
MDL | MFCD00866946 |
Melting point | 292-294 °C |
Boiling point | 292-294°C |
Chemical Stability | Incompatible with strong oxidizing agents. |
Safe Property | S26-S45 |
Hazard Category Code | R25;R36/37/38 |
Water Solubility | DMSO: 3 mg/mL |
Storage | OK to freezeprotect from light 2-8°C |
Smiles | C(C(C)C)N1C=2C=3C(N=C(N)C2N=C1)=CC=CC3 |
InchiKey | DOUYETYNHWVLEO-UHFFFAOYSA-N |