Product Name | 3-O-Acetyl-1,2-O-isopropylidene-α-D-allofuranose |
---|---|
CAS | 51433-05-7 |
Formula | C11H18O7 |
MW | 262.26 |
Boiling point | 392.0±42.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 3-O-Acetyl-1,2-O-isopropylidene-α-D-allofuranose |
---|---|
CAS | 51433-05-7 |
Formula | C11H18O7 |
MW | 262.26 |
Boiling point | 392.0±42.0 °C(lit.) |
CAS | 51433-05-7 |
---|---|
Formula | C11H18O7 |
MW | 262.26 |
Boiling point | 392.0±42.0 °C(lit.) |
特性 | * |
Smiles | O([CH]1[C]([H])(O[C]2([H])OC(C)(C)O[C]12[H])[CH](O)CO)C(=O)C |
InchiKey | MWHWTXULRQTAPZ-UHFFFAOYSA-N |